tetraethylene glycol dibutyl ether


dibutoxytetraethylene glycol; dibutoxytetraglycol; tetraethylene glycol dibutyl ether
CAS RN:[112-98-1]
Formula:C16H34O5; 306.44 g/mol
InChiKey:MQGIBEAIDUOVOH-UHFFFAOYSA-N
SMILES:O(CCOCCOCCCC)CCOCCOCCCC
Molecular structure of tetraethylene glycol dibutyl ether
Use:inert reaction or extraction medium; lubricant; plasticizer; solvent
Toxicology (LD50):10 000 mg/Kg (rabbit, ct); 6 500 mg/Kg(rat, or)
Density:0.944 g/mL
Molar volume:324.8 mL/mol
Refractive index:1.454
Molecular refractive power:87.90 mL/mol
Boiling point:331 °C
Miscible with:
1,2-diethoxyethane,    1,3-propanediol,    2,4-pentanedione,    2-(2-aminoethylamino)ethanol,    2-amino-2-methyl-1-propanol,    2-ethylhexanol,    2-methyl-1-propanethiol,    3-methyl-1-butanol,    4-hydroxy-4-methylpentan-2-one,    4-methyl-2-pentanone,    N,N-dimethylaniline,    N,N-dipropylaniline,    benzaldehyde,    benzene,    benzonitrile,    benzothiazole,    benzyl alcohol,    butanol,    butyl acetate,    diethyl ether,    dimethyl disulfide,    ethanediol,    ethanol,    ethyl benzoate,    ethyl isothiocyanate,    ethyl thiocyanate,    formamide,    furfuryl alcohol,    hexanedinitrile,    isoamyl sulfide,    nitromethane,    octanol,    phenylmethanethiol,    pyridine,    tetrachloromethane,    tributylamine

Isomers

tetraethylene glycol dibutyl ether
Molecular structure of tetraethylene glycol dibutyl ether
tetraethylene glycol monooctyl ether
Molecular structure of tetraethylene glycol monooctyl ether